C20H22N4O3S — CID 38208820
[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(1H-indazol-7-yl)methanone (PubChem CID 38208820) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(1H-indazol-7-yl)methanone.
| Compound Name | [4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(1H-indazol-7-yl)methanone |
|---|---|
| PubChem CID | 38208820 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(1H-indazol-7-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3cccc4cn[nH]c34)CC2)cc1C |
| InChI | InChI=1S/C20H22N4O3S/c1-14-6-7-17(12-15(14)2)28(26,27)24-10-8-23(9-11-24)20(25)18-5-3-4-16-13-21-22-19(16)18/h3-7,12-13H,8-11H2,1-2H3,(H,21,22) |
| InChIKey | SYVIMPJTWSDCBL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |