C22H25N3O3S — CID 60550687
1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-indol-1-ylethanone (PubChem CID 60550687) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-indol-1-ylethanone.
| Compound Name | 1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-indol-1-ylethanone |
|---|---|
| PubChem CID | 60550687 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-2-indol-1-ylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)Cn3ccc4ccccc43)CC2)cc1C |
| InChI | InChI=1S/C22H25N3O3S/c1-17-7-8-20(15-18(17)2)29(27,28)25-13-11-23(12-14-25)22(26)16-24-10-9-19-5-3-4-6-21(19)24/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | OZZCCZTVENMPQK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |