C17H16Cl2N2O3S — CID 23853559
[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-phenylmethanone (PubChem CID 23853559) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 23853559 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H16Cl2N2O3S/c18-15-7-6-14(12-16(15)19)25(23,24)21-10-8-20(9-11-21)17(22)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | CSPWROZOQRIEDI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |