C19H17Cl2N3O3S — CID 36723786
[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-(1H-indol-2-yl)methanone (PubChem CID 36723786) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 36723786 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c20-15-6-5-14(12-16(15)21)28(26,27)24-9-7-23(8-10-24)19(25)18-11-13-3-1-2-4-17(13)22-18/h1-6,11-12,22H,7-10H2 |
| InChIKey | OJQHWZRTQIRJCR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |