C22H28N4O5S2 — CID 55339492
[4-(benzenesulfonyl)piperazin-1-yl]-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]methanone (PubChem CID 55339492) has the molecular formula C22H28N4O5S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 55339492 |
| Molecular Formula | C22H28N4O5S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]methanone |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)N3CCN(S(=O)(=O)c4ccccc4)CC3)c2)CC1 |
| InChI | InChI=1S/C22H28N4O5S2/c1-23-10-14-25(15-11-23)33(30,31)21-9-5-6-19(18-21)22(27)24-12-16-26(17-13-24)32(28,29)20-7-3-2-4-8-20/h2-9,18H,10-17H2,1H3 |
| InChIKey | WBZMMZXRYLJMAI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |