C22H27FN4O3S — CID 78773750
[3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylphenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 78773750) has the molecular formula C22H27FN4O3S and a molecular weight of 446.55 g/mol. Its IUPAC name is [3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylphenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylphenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 78773750 |
| Molecular Formula | C22H27FN4O3S |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [3-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylphenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc(S(=O)(=O)N3CCN(c4ccc(F)cc4)CC3)c2)CC1 |
| InChI | InChI=1S/C22H27FN4O3S/c1-24-9-11-26(12-10-24)22(28)18-3-2-4-21(17-18)31(29,30)27-15-13-25(14-16-27)20-7-5-19(23)6-8-20/h2-8,17H,9-16H2,1H3 |
| InChIKey | MVLGIERRNLNRAF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |