C17H24N4O4S — CID 110408530
4-[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]piperazine-1-carbaldehyde (PubChem CID 110408530) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110408530 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]piperazine-1-carbaldehyde |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)N3CCN(C=O)CC3)c2)CC1 |
| InChI | InChI=1S/C17H24N4O4S/c1-18-5-11-21(12-6-18)26(24,25)16-4-2-3-15(13-16)17(23)20-9-7-19(14-22)8-10-20/h2-4,13-14H,5-12H2,1H3 |
| InChIKey | RBZQLEIDQJBIKE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|