C23H34N4O4S — CID 24627712
[3-(azepan-1-ylsulfonyl)phenyl]-[4-(piperidine-1-carbonyl)piperazin-1-yl]methanone (PubChem CID 24627712) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is [3-(azepan-1-ylsulfonyl)phenyl]-[4-(piperidine-1-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [3-(azepan-1-ylsulfonyl)phenyl]-[4-(piperidine-1-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24627712 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [3-(azepan-1-ylsulfonyl)phenyl]-[4-(piperidine-1-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(S(=O)(=O)N2CCCCCC2)c1)N1CCN(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34N4O4S/c28-22(24-15-17-26(18-16-24)23(29)25-11-4-3-5-12-25)20-9-8-10-21(19-20)32(30,31)27-13-6-1-2-7-14-27/h8-10,19H,1-7,11-18H2 |
| InChIKey | BDWUCFJYWRUMLQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |