C23H35N3O4S — CID 55922769
1-[4-[3-(azepan-1-ylsulfonyl)benzoyl]piperazin-1-yl]-4-methylpentan-1-one (PubChem CID 55922769) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[4-[3-(azepan-1-ylsulfonyl)benzoyl]piperazin-1-yl]-4-methylpentan-1-one.
| Compound Name | 1-[4-[3-(azepan-1-ylsulfonyl)benzoyl]piperazin-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 55922769 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-[4-[3-(azepan-1-ylsulfonyl)benzoyl]piperazin-1-yl]-4-methylpentan-1-one |
| SMILES | CC(C)CCC(=O)N1CCN(C(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H35N3O4S/c1-19(2)10-11-22(27)24-14-16-25(17-15-24)23(28)20-8-7-9-21(18-20)31(29,30)26-12-5-3-4-6-13-26/h7-9,18-19H,3-6,10-17H2,1-2H3 |
| InChIKey | LWKVKVFCNZTVAB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |