C20H31N3O3S — CID 119647439
[4-(ethylaminomethyl)piperidin-1-yl]-(3-piperidin-1-ylsulfonylphenyl)methanone (PubChem CID 119647439) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is [4-(ethylaminomethyl)piperidin-1-yl]-(3-piperidin-1-ylsulfonylphenyl)methanone.
| Compound Name | [4-(ethylaminomethyl)piperidin-1-yl]-(3-piperidin-1-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 119647439 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [4-(ethylaminomethyl)piperidin-1-yl]-(3-piperidin-1-ylsulfonylphenyl)methanone |
| SMILES | CCNCC1CCN(C(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C20H31N3O3S/c1-2-21-16-17-9-13-22(14-10-17)20(24)18-7-6-8-19(15-18)27(25,26)23-11-4-3-5-12-23/h6-8,15,17,21H,2-5,9-14,16H2,1H3 |
| InChIKey | XPXNAGKHKASJAZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |