C21H34N4O5S2 — CID 24584449
4-[3-(azepan-1-ylsulfonyl)benzoyl]-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 24584449) has the molecular formula C21H34N4O5S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 4-[3-(azepan-1-ylsulfonyl)benzoyl]-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-[3-(azepan-1-ylsulfonyl)benzoyl]-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 24584449 |
| Molecular Formula | C21H34N4O5S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[3-(azepan-1-ylsulfonyl)benzoyl]-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H34N4O5S2/c1-3-23(4-2)32(29,30)25-16-14-22(15-17-25)21(26)19-10-9-11-20(18-19)31(27,28)24-12-7-5-6-8-13-24/h9-11,18H,3-8,12-17H2,1-2H3 |
| InChIKey | PMFOJQCQZWQBPY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |