C18H26N2O4S — CID 55922896
4-methyl-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]pentan-1-one (PubChem CID 55922896) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-methyl-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 4-methyl-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 55922896 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-methyl-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]pentan-1-one |
| SMILES | CC(C)CCC(=O)N1CCN(C(=O)c2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-14(2)7-8-17(21)19-9-11-20(12-10-19)18(22)15-5-4-6-16(13-15)25(3,23)24/h4-6,13-14H,7-12H2,1-3H3 |
| InChIKey | HRPIZDYBFUECOH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |