C19H29N3O4S — CID 110619816
3-(diethylamino)-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]propan-1-one (PubChem CID 110619816) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-(diethylamino)-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(diethylamino)-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 110619816 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-(diethylamino)-1-[4-(3-methylsulfonylbenzoyl)piperazin-1-yl]propan-1-one |
| SMILES | CCN(CC)CCC(=O)N1CCN(C(=O)c2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C19H29N3O4S/c1-4-20(5-2)10-9-18(23)21-11-13-22(14-12-21)19(24)16-7-6-8-17(15-16)27(3,25)26/h6-8,15H,4-5,9-14H2,1-3H3 |
| InChIKey | KGEBSSPDEZKDCJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |