C16H23Cl2N3O2 — CID 120559709
4-amino-1-[4-(3-chlorobenzoyl)piperazin-1-yl]pentan-1-one;hydrochloride (PubChem CID 120559709) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 4-amino-1-[4-(3-chlorobenzoyl)piperazin-1-yl]pentan-1-one;hydrochloride.
| Compound Name | 4-amino-1-[4-(3-chlorobenzoyl)piperazin-1-yl]pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120559709 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-amino-1-[4-(3-chlorobenzoyl)piperazin-1-yl]pentan-1-one;hydrochloride |
| SMILES | CC(N)CCC(=O)N1CCN(C(=O)c2cccc(Cl)c2)CC1.Cl |
| InChI | InChI=1S/C16H22ClN3O2.ClH/c1-12(18)5-6-15(21)19-7-9-20(10-8-19)16(22)13-3-2-4-14(17)11-13;/h2-4,11-12H,5-10,18H2,1H3;1H |
| InChIKey | VSTJVHNLQKZDPH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |