C17H24ClN3O2 — CID 119302778
2-amino-1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 119302778) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 2-amino-1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 2-amino-1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 119302778 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-amino-1-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | CCCC(N)C(=O)N1CCCN(C(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-2-5-15(19)17(23)21-9-4-8-20(10-11-21)16(22)13-6-3-7-14(18)12-13/h3,6-7,12,15H,2,4-5,8-11,19H2,1H3 |
| InChIKey | ARKPOYKOKQYLAG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |