C20H22ClN3O2 — CID 119302772
[4-(aminomethyl)phenyl]-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 119302772) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [4-(aminomethyl)phenyl]-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 119302772 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [4-(aminomethyl)phenyl]-[4-(3-chlorobenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | NCc1ccc(C(=O)N2CCCN(C(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22ClN3O2/c21-18-4-1-3-17(13-18)20(26)24-10-2-9-23(11-12-24)19(25)16-7-5-15(14-22)6-8-16/h1,3-8,13H,2,9-12,14,22H2 |
| InChIKey | FNUHOPJIGSNDAH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |