C20H21ClN2O2 — CID 110798191
1-(4-benzoyl-1,4-diazepan-1-yl)-2-(3-chlorophenyl)ethanone (PubChem CID 110798191) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(3-chlorophenyl)ethanone.
| Compound Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(3-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 110798191 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(4-benzoyl-1,4-diazepan-1-yl)-2-(3-chlorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21ClN2O2/c21-18-9-4-6-16(14-18)15-19(24)22-10-5-11-23(13-12-22)20(25)17-7-2-1-3-8-17/h1-4,6-9,14H,5,10-13,15H2 |
| InChIKey | CGUKQRWZNDIDIU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |