C16H21Cl2N3O2 — CID 119281994
2-amino-1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]pentan-1-one (PubChem CID 119281994) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2-amino-1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 2-amino-1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 119281994 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-amino-1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]pentan-1-one |
| SMILES | CCCC(N)C(=O)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-2-3-14(19)16(23)21-8-6-20(7-9-21)15(22)12-5-4-11(17)10-13(12)18/h4-5,10,14H,2-3,6-9,19H2,1H3 |
| InChIKey | YIMPUKDYEAGYNW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |