C14H16Cl2N2O3 — CID 62317244
2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanoic acid (PubChem CID 62317244) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 62317244 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-9(14(20)21)17-4-6-18(7-5-17)13(19)11-3-2-10(15)8-12(11)16/h2-3,8-9H,4-7H2,1H3,(H,20,21) |
| InChIKey | KAPRTDSAUAMAMB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |