C21H23Cl2N3O2 — CID 46444763
N-benzyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanamide (PubChem CID 46444763) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is N-benzyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanamide.
| Compound Name | N-benzyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46444763 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-benzyl-2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NCc1ccccc1)N1CCN(C(=O)c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-15(20(27)24-14-16-5-3-2-4-6-16)25-9-11-26(12-10-25)21(28)18-8-7-17(22)13-19(18)23/h2-8,13,15H,9-12,14H2,1H3,(H,24,27) |
| InChIKey | MTTFYBZJUZUEPV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |