C26H32ClN3O2 — CID 34894788
(2R)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]propan-1-one (PubChem CID 34894788) has the molecular formula C26H32ClN3O2 and a molecular weight of 454.01 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]propan-1-one.
| Compound Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 34894788 |
| Molecular Formula | C26H32ClN3O2 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-[4-(2-chlorobenzoyl)piperazin-1-yl]propan-1-one |
| SMILES | C[C@H](C(=O)N1CCC(Cc2ccccc2)CC1)N1CCN(C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H32ClN3O2/c1-20(25(31)29-13-11-22(12-14-29)19-21-7-3-2-4-8-21)28-15-17-30(18-16-28)26(32)23-9-5-6-10-24(23)27/h2-10,20,22H,11-19H2,1H3/t20-/m1/s1 |
| InChIKey | PZWOKYBLBUSGPR-HXUWFJFHSA-N |
| XLogP | 3.97 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |