C25H32FN3O — CID 9431608
(2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 9431608) has the molecular formula C25H32FN3O and a molecular weight of 409.55 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 9431608 |
| Molecular Formula | C25H32FN3O |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | (2S)-1-(4-benzylpiperidin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | C[C@@H](C(=O)N1CCC(Cc2ccccc2)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H32FN3O/c1-20(27-15-17-28(18-16-27)24-9-7-23(26)8-10-24)25(30)29-13-11-22(12-14-29)19-21-5-3-2-4-6-21/h2-10,20,22H,11-19H2,1H3/t20-/m0/s1 |
| InChIKey | XJWINARCZXSCND-FQEVSTJZSA-N |
| XLogP | 3.82 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |