C24H31FN4O — CID 17496772
1-(4-benzylpiperazin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one (PubChem CID 17496772) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 17496772 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C(=O)N1CCN(Cc2ccccc2)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H31FN4O/c1-20(27-15-17-28(18-16-27)23-9-7-22(25)8-10-23)24(30)29-13-11-26(12-14-29)19-21-5-3-2-4-6-21/h2-10,20H,11-19H2,1H3 |
| InChIKey | OZAJZHFXGDQTLI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |