C16H21N3O4S — CID 109063117
4-[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylpiperazine-1-carbaldehyde (PubChem CID 109063117) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylpiperazine-1-carbaldehyde.
| Compound Name | 4-[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109063117 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-[3-(pyrrolidine-1-carbonyl)phenyl]sulfonylpiperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(S(=O)(=O)c2cccc(C(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C16H21N3O4S/c20-13-17-8-10-19(11-9-17)24(22,23)15-5-3-4-14(12-15)16(21)18-6-1-2-7-18/h3-5,12-13H,1-2,6-11H2 |
| InChIKey | LAWPASPVWNRWNY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|