C17H19FN2O4S2 — CID 2995650
1-(4-fluorophenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine (PubChem CID 2995650) has the molecular formula C17H19FN2O4S2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine.
| Compound Name | 1-(4-fluorophenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 2995650 |
| Molecular Formula | C17H19FN2O4S2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C17H19FN2O4S2/c1-25(21,22)16-3-2-4-17(13-16)26(23,24)20-11-9-19(10-12-20)15-7-5-14(18)6-8-15/h2-8,13H,9-12H2,1H3 |
| InChIKey | GJXZOLWQFUFEFK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |