C18H22N2O5S2 — CID 55559198
1-(4-methoxyphenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine (PubChem CID 55559198) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine.
| Compound Name | 1-(4-methoxyphenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 55559198 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-(3-methylsulfonylphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cccc(S(C)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-25-16-8-6-15(7-9-16)19-10-12-20(13-11-19)27(23,24)18-5-3-4-17(14-18)26(2,21)22/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | OYQZWBUOAQMYRK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|