C19H18F6N2O3S — CID 3756188
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)piperazine (PubChem CID 3756188) has the molecular formula C19H18F6N2O3S and a molecular weight of 468.42 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3756188 |
| Molecular Formula | C19H18F6N2O3S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H18F6N2O3S/c1-30-16-4-2-15(3-5-16)26-6-8-27(9-7-26)31(28,29)17-11-13(18(20,21)22)10-14(12-17)19(23,24)25/h2-5,10-12H,6-9H2,1H3 |
| InChIKey | PLDYEHBJTHTKLV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|