C18H15F7N2O2S — CID 26946811
1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-fluorophenyl)piperazine (PubChem CID 26946811) has the molecular formula C18H15F7N2O2S and a molecular weight of 456.38 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-fluorophenyl)piperazine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 26946811 |
| Molecular Formula | C18H15F7N2O2S |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-4-(2-fluorophenyl)piperazine |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H15F7N2O2S/c19-15-3-1-2-4-16(15)26-5-7-27(8-6-26)30(28,29)14-10-12(17(20,21)22)9-13(11-14)18(23,24)25/h1-4,9-11H,5-8H2 |
| InChIKey | DELQYBRAYVHUGT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |