C19H19FN4O4S — CID 46341336
7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 46341336) has the molecular formula C19H19FN4O4S and a molecular weight of 418.45 g/mol. Its IUPAC name is 7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 46341336 |
| Molecular Formula | C19H19FN4O4S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 7-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)Nc2cc(S(=O)(=O)N3CCN(c4ccccc4F)CC3)ccc2N1 |
| InChI | InChI=1S/C19H19FN4O4S/c20-14-3-1-2-4-17(14)23-7-9-24(10-8-23)29(27,28)13-5-6-15-16(11-13)22-19(26)12-18(25)21-15/h1-6,11H,7-10,12H2,(H,21,25)(H,22,26) |
| InChIKey | JPWYSIAXWBXFKX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|