C19H24N2O3S — CID 2478081
1-(3,4-dimethylphenyl)sulfonyl-4-(4-methoxyphenyl)piperazine (PubChem CID 2478081) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 2478081 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O3S/c1-15-4-9-19(14-16(15)2)25(22,23)21-12-10-20(11-13-21)17-5-7-18(24-3)8-6-17/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | CCUPIITVHHCODX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|