C20H26N2O2S — CID 113075942
1-(3,4-dimethylphenyl)sulfonyl-4-(4-ethylphenyl)piperazine (PubChem CID 113075942) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-4-(4-ethylphenyl)piperazine.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-4-(4-ethylphenyl)piperazine |
|---|---|
| PubChem CID | 113075942 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-4-(4-ethylphenyl)piperazine |
| SMILES | CCc1ccc(N2CCN(S(=O)(=O)c3ccc(C)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-4-18-6-8-19(9-7-18)21-11-13-22(14-12-21)25(23,24)20-10-5-16(2)17(3)15-20/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | JNVJMMLHAPXMOY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|