C20H27N3O3S — CID 113078794
4-[4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylaniline (PubChem CID 113078794) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-[4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 113078794 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc(N(C)C)cc3)CC2)cc1C |
| InChI | InChI=1S/C20H27N3O3S/c1-16-15-19(9-10-20(16)26-4)27(24,25)23-13-11-22(12-14-23)18-7-5-17(6-8-18)21(2)3/h5-10,15H,11-14H2,1-4H3 |
| InChIKey | BGOCCHGGJDSFBQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|