C14H23N2O3S+ — CID 6957248
1-ethyl-4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-ium (PubChem CID 6957248) has the molecular formula C14H23N2O3S+ and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-ethyl-4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-ethyl-4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 6957248 |
| Molecular Formula | C14H23N2O3S+ |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-ethyl-4-(4-methoxy-3-methylphenyl)sulfonylpiperazin-1-ium |
| SMILES | CC[NH+]1CCN(S(=O)(=O)c2ccc(OC)c(C)c2)CC1 |
| InChI | InChI=1S/C14H22N2O3S/c1-4-15-7-9-16(10-8-15)20(17,18)13-5-6-14(19-3)12(2)11-13/h5-6,11H,4,7-10H2,1-3H3/p+1 |
| InChIKey | WNSZIPYAVBFSOF-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |