C16H26N3O4S2+ — CID 7768351
1-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazin-1-ium (PubChem CID 7768351) has the molecular formula C16H26N3O4S2+ and a molecular weight of 388.54 g/mol. Its IUPAC name is 1-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 7768351 |
| Molecular Formula | C16H26N3O4S2+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-ethyl-4-(4-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazin-1-ium |
| SMILES | CC[NH+]1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C16H25N3O4S2/c1-2-17-11-13-19(14-12-17)25(22,23)16-7-5-15(6-8-16)24(20,21)18-9-3-4-10-18/h5-8H,2-4,9-14H2,1H3/p+1 |
| InChIKey | FDHODCWWTZTDTK-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |