C18H17F6N3O2S — CID 21314935
4-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylaniline (PubChem CID 21314935) has the molecular formula C18H17F6N3O2S and a molecular weight of 453.41 g/mol. Its IUPAC name is 4-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylaniline.
| Compound Name | 4-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 21314935 |
| Molecular Formula | C18H17F6N3O2S |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 4-[4-[3,5-bis(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylaniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCN(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C18H17F6N3O2S/c19-17(20,21)12-9-13(18(22,23)24)11-15(10-12)26-5-7-27(8-6-26)30(28,29)16-3-1-14(25)2-4-16/h1-4,9-11H,5-8,25H2 |
| InChIKey | RSWQKZZMPUKQOU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|