C16H17Cl2N3O2S — CID 166075301
4-[4-(3,5-dichlorophenyl)piperazin-1-yl]sulfonylaniline (PubChem CID 166075301) has the molecular formula C16H17Cl2N3O2S and a molecular weight of 386.30 g/mol. Its IUPAC name is 4-[4-(3,5-dichlorophenyl)piperazin-1-yl]sulfonylaniline.
| Compound Name | 4-[4-(3,5-dichlorophenyl)piperazin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 166075301 |
| Molecular Formula | C16H17Cl2N3O2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 4-[4-(3,5-dichlorophenyl)piperazin-1-yl]sulfonylaniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C16H17Cl2N3O2S/c17-12-9-13(18)11-15(10-12)20-5-7-21(8-6-20)24(22,23)16-3-1-14(19)2-4-16/h1-4,9-11H,5-8,19H2 |
| InChIKey | RYZYWAJEYZFAFC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|