C16H15Cl3N2O2S — CID 3708259
1-(4-chlorophenyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine (PubChem CID 3708259) has the molecular formula C16H15Cl3N2O2S and a molecular weight of 405.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-(4-chlorophenyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 3708259 |
| Molecular Formula | C16H15Cl3N2O2S |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H15Cl3N2O2S/c17-12-1-3-13(4-2-12)20-7-9-21(10-8-20)24(22,23)14-5-6-15(18)16(19)11-14/h1-6,11H,7-10H2 |
| InChIKey | FHKUWSFSGGOBQU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |