C20H25Cl2N5O2S — CID 26843190
1-[6-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane (PubChem CID 26843190) has the molecular formula C20H25Cl2N5O2S and a molecular weight of 470.43 g/mol. Its IUPAC name is 1-[6-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane.
| Compound Name | 1-[6-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane |
|---|---|
| PubChem CID | 26843190 |
| Molecular Formula | C20H25Cl2N5O2S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1-[6-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]pyridazin-3-yl]azepane |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCN(c2ccc(N3CCCCCC3)nn2)CC1 |
| InChI | InChI=1S/C20H25Cl2N5O2S/c21-17-6-5-16(15-18(17)22)30(28,29)27-13-11-26(12-14-27)20-8-7-19(23-24-20)25-9-3-1-2-4-10-25/h5-8,15H,1-4,9-14H2 |
| InChIKey | FKMBWMSCXRHYCV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |