C21H24Cl2N4O4S — CID 2942744
1-(3,4-dichlorophenyl)sulfonyl-4-(4-nitro-3-piperidin-1-ylphenyl)piperazine (PubChem CID 2942744) has the molecular formula C21H24Cl2N4O4S and a molecular weight of 499.42 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonyl-4-(4-nitro-3-piperidin-1-ylphenyl)piperazine.
| Compound Name | 1-(3,4-dichlorophenyl)sulfonyl-4-(4-nitro-3-piperidin-1-ylphenyl)piperazine |
|---|---|
| PubChem CID | 2942744 |
| Molecular Formula | C21H24Cl2N4O4S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonyl-4-(4-nitro-3-piperidin-1-ylphenyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)cc1N1CCCCC1 |
| InChI | InChI=1S/C21H24Cl2N4O4S/c22-18-6-5-17(15-19(18)23)32(30,31)26-12-10-24(11-13-26)16-4-7-20(27(28)29)21(14-16)25-8-2-1-3-9-25/h4-7,14-15H,1-3,8-13H2 |
| InChIKey | RCZFAQIOHSIHRO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|