C26H27Cl2N5O4S — CID 4215812
1-[5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-4-phenylpiperazine (PubChem CID 4215812) has the molecular formula C26H27Cl2N5O4S and a molecular weight of 576.51 g/mol. Its IUPAC name is 1-[5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-4-phenylpiperazine.
| Compound Name | 1-[5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 4215812 |
| Molecular Formula | C26H27Cl2N5O4S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 1-[5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitrophenyl]-4-phenylpiperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)cc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27Cl2N5O4S/c27-23-8-7-22(19-24(23)28)38(36,37)32-16-14-30(15-17-32)21-6-9-25(33(34)35)26(18-21)31-12-10-29(11-13-31)20-4-2-1-3-5-20/h1-9,18-19H,10-17H2 |
| InChIKey | SJZXIRDHLFEHSE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 90.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|