C16H14Cl2FN3O4S — CID 26451257
1-(3,4-dichlorophenyl)sulfonyl-4-(4-fluoro-2-nitrophenyl)piperazine (PubChem CID 26451257) has the molecular formula C16H14Cl2FN3O4S and a molecular weight of 434.28 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonyl-4-(4-fluoro-2-nitrophenyl)piperazine.
| Compound Name | 1-(3,4-dichlorophenyl)sulfonyl-4-(4-fluoro-2-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 26451257 |
| Molecular Formula | C16H14Cl2FN3O4S |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonyl-4-(4-fluoro-2-nitrophenyl)piperazine |
| SMILES | O=[N+]([O-])c1cc(F)ccc1N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H14Cl2FN3O4S/c17-13-3-2-12(10-14(13)18)27(25,26)21-7-5-20(6-8-21)15-4-1-11(19)9-16(15)22(23)24/h1-4,9-10H,5-8H2 |
| InChIKey | DHQHWWPAIFEREE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|