C28H34Cl2N4O4S — CID 4201638
N-[1-(1-adamantyl)ethyl]-5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitroaniline (PubChem CID 4201638) has the molecular formula C28H34Cl2N4O4S and a molecular weight of 593.58 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitroaniline.
| Compound Name | N-[1-(1-adamantyl)ethyl]-5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 4201638 |
| Molecular Formula | C28H34Cl2N4O4S |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-5-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-2-nitroaniline |
| SMILES | CC(Nc1cc(N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)ccc1[N+](=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H34Cl2N4O4S/c1-18(28-15-19-10-20(16-28)12-21(11-19)17-28)31-26-13-22(2-5-27(26)34(35)36)32-6-8-33(9-7-32)39(37,38)23-3-4-24(29)25(30)14-23/h2-5,13-14,18-21,31H,6-12,15-17H2,1H3 |
| InChIKey | OLOPHTOKWFJOFF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|