C29H33ClF2N4O3 — CID 98076579
[4-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-4-nitrophenyl]piperazin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone (PubChem CID 98076579) has the molecular formula C29H33ClF2N4O3 and a molecular weight of 559.06 g/mol. Its IUPAC name is [4-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-4-nitrophenyl]piperazin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone.
| Compound Name | [4-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-4-nitrophenyl]piperazin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 98076579 |
| Molecular Formula | C29H33ClF2N4O3 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | [4-[3-[[(1R)-1-(1-adamantyl)ethyl]amino]-4-nitrophenyl]piperazin-1-yl]-(2-chloro-4,5-difluorophenyl)methanone |
| SMILES | C[C@@H](Nc1cc(N2CCN(C(=O)c3cc(F)c(F)cc3Cl)CC2)ccc1[N+](=O)[O-])C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H33ClF2N4O3/c1-17(29-14-18-8-19(15-29)10-20(9-18)16-29)33-26-11-21(2-3-27(26)36(38)39)34-4-6-35(7-5-34)28(37)22-12-24(31)25(32)13-23(22)30/h2-3,11-13,17-20,33H,4-10,14-16H2,1H3/t17-,18?,19?,20?,29?/m1/s1 |
| InChIKey | XOSIEZHSPZAVAY-KVXAFKILSA-N |
| XLogP | 6.51 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|