C30H38N4O3 — CID 3737936
[4-[3-[1-(1-adamantyl)ethylamino]-4-nitrophenyl]piperazin-1-yl]-(4-methylphenyl)methanone (PubChem CID 3737936) has the molecular formula C30H38N4O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is [4-[3-[1-(1-adamantyl)ethylamino]-4-nitrophenyl]piperazin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[3-[1-(1-adamantyl)ethylamino]-4-nitrophenyl]piperazin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 3737936 |
| Molecular Formula | C30H38N4O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | [4-[3-[1-(1-adamantyl)ethylamino]-4-nitrophenyl]piperazin-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc([N+](=O)[O-])c(NC(C)C45CC6CC(CC(C6)C4)C5)c3)CC2)cc1 |
| InChI | InChI=1S/C30H38N4O3/c1-20-3-5-25(6-4-20)29(35)33-11-9-32(10-12-33)26-7-8-28(34(36)37)27(16-26)31-21(2)30-17-22-13-23(18-30)15-24(14-22)19-30/h3-8,16,21-24,31H,9-15,17-19H2,1-2H3 |
| InChIKey | DUPMRUDRSQREKR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|