C17H14ClF2N3O5S — CID 42993433
(2-chloro-4,5-difluorophenyl)-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 42993433) has the molecular formula C17H14ClF2N3O5S and a molecular weight of 445.83 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42993433 |
| Molecular Formula | C17H14ClF2N3O5S |
| Molecular Weight | 445.83 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H14ClF2N3O5S/c18-12-10-14(20)13(19)9-11(12)17(24)21-5-7-22(8-6-21)29(27,28)16-4-2-1-3-15(16)23(25)26/h1-4,9-10H,5-8H2 |
| InChIKey | XKEAHHUBGXTJGQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|