C19H18FN3O7S — CID 55365594
[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone (PubChem CID 55365594) has the molecular formula C19H18FN3O7S and a molecular weight of 451.43 g/mol. Its IUPAC name is [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
|---|---|
| PubChem CID | 55365594 |
| Molecular Formula | C19H18FN3O7S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
| SMILES | O=C(c1cc2c(cc1[N+](=O)[O-])OCCO2)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H18FN3O7S/c20-14-3-1-2-4-18(14)31(27,28)22-7-5-21(6-8-22)19(24)13-11-16-17(30-10-9-29-16)12-15(13)23(25)26/h1-4,11-12H,5-10H2 |
| InChIKey | DCXNUYFIVLGYQT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|