C18H18FN3O6S — CID 26261350
[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(2-methoxy-5-nitrophenyl)methanone (PubChem CID 26261350) has the molecular formula C18H18FN3O6S and a molecular weight of 423.42 g/mol. Its IUPAC name is [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(2-methoxy-5-nitrophenyl)methanone.
| Compound Name | [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(2-methoxy-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 26261350 |
| Molecular Formula | C18H18FN3O6S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(2-methoxy-5-nitrophenyl)methanone |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H18FN3O6S/c1-28-16-7-6-13(22(24)25)12-14(16)18(23)20-8-10-21(11-9-20)29(26,27)17-5-3-2-4-15(17)19/h2-7,12H,8-11H2,1H3 |
| InChIKey | LYUZRCWPAIYLAR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|