C20H19ClFN3O5 — CID 55371397
[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone (PubChem CID 55371397) has the molecular formula C20H19ClFN3O5 and a molecular weight of 435.84 g/mol. Its IUPAC name is [4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone.
| Compound Name | [4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
|---|---|
| PubChem CID | 55371397 |
| Molecular Formula | C20H19ClFN3O5 |
| Molecular Weight | 435.84 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | [4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
| SMILES | O=C(c1cc2c(cc1[N+](=O)[O-])OCCO2)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C20H19ClFN3O5/c21-15-2-1-3-16(22)14(15)12-23-4-6-24(7-5-23)20(26)13-10-18-19(30-9-8-29-18)11-17(13)25(27)28/h1-3,10-11H,4-9,12H2 |
| InChIKey | DSMTYAPIMQWAKA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.84 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|