C22H24ClFN4O3 — CID 55882469
[5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 55882469) has the molecular formula C22H24ClFN4O3 and a molecular weight of 446.91 g/mol. Its IUPAC name is [5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 55882469 |
| Molecular Formula | C22H24ClFN4O3 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [5-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(N2CCN(Cc3c(F)cccc3Cl)CC2)ccc1[N+](=O)[O-])N1CCCC1 |
| InChI | InChI=1S/C22H24ClFN4O3/c23-19-4-3-5-20(24)18(19)15-25-10-12-26(13-11-25)16-6-7-21(28(30)31)17(14-16)22(29)27-8-1-2-9-27/h3-7,14H,1-2,8-13,15H2 |
| InChIKey | GACVFWIPCGBREB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|