C20H25N5O3S — CID 133276127
[2-nitro-5-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 133276127) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is [2-nitro-5-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-nitro-5-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 133276127 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [2-nitro-5-[4-(1,3-thiazol-4-ylmethyl)-1,4-diazepan-1-yl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(N2CCCN(Cc3cscn3)CC2)ccc1[N+](=O)[O-])N1CCCC1 |
| InChI | InChI=1S/C20H25N5O3S/c26-20(24-7-1-2-8-24)18-12-17(4-5-19(18)25(27)28)23-9-3-6-22(10-11-23)13-16-14-29-15-21-16/h4-5,12,14-15H,1-3,6-11,13H2 |
| InChIKey | YRUPCMAHZPMVRD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|